C33H24N4O2SZn+2 — CID 158989153
zinc methyl 4-[3-(5-methylthiophen-2-yl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 158989153) has the molecular formula C33H24N4O2SZn+2 and a molecular weight of 606.04 g/mol. Its IUPAC name is zinc methyl 4-[3-(5-methylthiophen-2-yl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | zinc methyl 4-[3-(5-methylthiophen-2-yl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 158989153 |
| Molecular Formula | C33H24N4O2SZn+2 |
| Molecular Weight | 606.04 g/mol |
| Exact Mass | 604.09 |
| IUPAC Name | zinc methyl 4-[3-(5-methylthiophen-2-yl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(cc4ccc(cc5nc(cc6cc(-c7ccc(C)s7)c2[nH]6)C=C5)[nH]4)C=C3)cc1.[Zn+2] |
| InChI | InChI=1S/C33H24N4O2S.Zn/c1-19-3-14-30(40-19)28-18-27-17-25-11-10-23(35-25)15-22-8-9-24(34-22)16-26-12-13-29(36-26)31(32(28)37-27)20-4-6-21(7-5-20)33(38)39-2;/h3-18,34,37H,1-2H3;/q;+2/b22-15-,23-15-,24-16-,25-17-,26-16-,27-17-,31-29-,32-31-; |
| InChIKey | JPYIWUWVFUEOKA-MXMPETIGSA-N |
| XLogP | 8.14 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.04 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|