C48H41N5 — CID 137287542
4,5,6,7-tetraphenyl-1-N,3-N-bis(4,5,6-trimethyl-2-pyridinyl)isoindole-1,3-diimine (PubChem CID 137287542) has the molecular formula C48H41N5 and a molecular weight of 687.89 g/mol. Its IUPAC name is 4,5,6,7-tetraphenyl-1-N,3-N-bis(4,5,6-trimethyl-2-pyridinyl)isoindole-1,3-diimine.
| Compound Name | 4,5,6,7-tetraphenyl-1-N,3-N-bis(4,5,6-trimethyl-2-pyridinyl)isoindole-1,3-diimine |
|---|---|
| PubChem CID | 137287542 |
| Molecular Formula | C48H41N5 |
| Molecular Weight | 687.89 g/mol |
| Exact Mass | 687.34 |
| IUPAC Name | 4,5,6,7-tetraphenyl-1-N,3-N-bis(4,5,6-trimethyl-2-pyridinyl)isoindole-1,3-diimine |
| SMILES | Cc1cc(/N=C2\N/C(=N\c3cc(C)c(C)c(C)n3)c3c2c(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c3-c2ccccc2)nc(C)c1C |
| InChI | InChI=1S/C48H41N5/c1-29-27-39(49-33(5)31(29)3)51-47-45-43(37-23-15-9-16-24-37)41(35-19-11-7-12-20-35)42(36-21-13-8-14-22-36)44(38-25-17-10-18-26-38)46(45)48(53-47)52-40-28-30(2)32(4)34(6)50-40/h7-28H,1-6H3,(H,49,50,51,52,53) |
| InChIKey | WWYKATJWIJYHHA-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.89 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|