C46H44N6O8 — CID 11803488
(2-nitrophenyl) 3-[8,13-diethyl-3,7,12,17-tetramethyl-18-[3-(2-nitrophenoxy)-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]propanoate (PubChem CID 11803488) has the molecular formula C46H44N6O8 and a molecular weight of 808.89 g/mol. Its IUPAC name is (2-nitrophenyl) 3-[8,13-diethyl-3,7,12,17-tetramethyl-18-[3-(2-nitrophenoxy)-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]propanoate.
| Compound Name | (2-nitrophenyl) 3-[8,13-diethyl-3,7,12,17-tetramethyl-18-[3-(2-nitrophenoxy)-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 11803488 |
| Molecular Formula | C46H44N6O8 |
| Molecular Weight | 808.89 g/mol |
| Exact Mass | 808.32 |
| IUPAC Name | (2-nitrophenyl) 3-[8,13-diethyl-3,7,12,17-tetramethyl-18-[3-(2-nitrophenoxy)-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]propanoate |
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)Oc1ccccc1[N+](=O)[O-])C(CCC(=O)Oc1ccccc1[N+](=O)[O-])=C4C)c(C)c3CC |
| InChI | InChI=1S/C46H44N6O8/c1-7-29-25(3)33-21-34-27(5)31(17-19-45(53)59-43-15-11-9-13-41(43)51(55)56)39(49-34)24-40-32(18-20-46(54)60-44-16-12-10-14-42(44)52(57)58)28(6)36(50-40)23-38-30(8-2)26(4)35(48-38)22-37(29)47-33/h9-16,21-24,47-48H,7-8,17-20H2,1-6H3/b33-21-,34-21-,35-22-,36-23-,37-22-,38-23-,39-24-,40-24- |
| InChIKey | QVLGJGNHMNATIX-OJKAWOKHSA-N |
| XLogP | 10.51 |
| TPSA | 196.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.89 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|