C40H38N4O16Pt+2 — CID 10373820
platinum(2+);3-[7,12,17-tris(2-carboxyethyl)-3,8,13,18-tetrakis(carboxymethyl)-21,24-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 10373820) has the molecular formula C40H38N4O16Pt+2 and a molecular weight of 1025.83 g/mol. Its IUPAC name is platinum(2+);3-[7,12,17-tris(2-carboxyethyl)-3,8,13,18-tetrakis(carboxymethyl)-21,24-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | platinum(2+);3-[7,12,17-tris(2-carboxyethyl)-3,8,13,18-tetrakis(carboxymethyl)-21,24-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 10373820 |
| Molecular Formula | C40H38N4O16Pt+2 |
| Molecular Weight | 1025.83 g/mol |
| Exact Mass | 1025.19 |
| IUPAC Name | platinum(2+);3-[7,12,17-tris(2-carboxyethyl)-3,8,13,18-tetrakis(carboxymethyl)-21,24-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | O=C(O)CCC1=C(CC(=O)O)c2cc3nc(cc4[nH]c(cc5[nH]c(cc1n2)c(CC(=O)O)c5CCC(=O)O)c(CC(=O)O)c4CCC(=O)O)C(CC(=O)O)=C3CCC(=O)O.[Pt+2] |
| InChI | InChI=1S/C40H38N4O16.Pt/c45-33(46)5-1-17-21(9-37(53)54)29-14-26-19(3-7-35(49)50)23(11-39(57)58)31(43-26)16-28-20(4-8-36(51)52)24(12-40(59)60)32(44-28)15-27-18(2-6-34(47)48)22(10-38(55)56)30(42-27)13-25(17)41-29;/h13-16,41-42H,1-12H2,(H,45,46)(H,47,48)(H,49,50)(H,51,52)(H,53,54)(H,55,56)(H,57,58)(H,59,60);/q;+2/b25-13-,26-14-,27-15-,28-16-,29-14-,30-13-,31-16-,32-15-; |
| InChIKey | FBUBHBKJQAQKFH-MXOXSBADSA-N |
| XLogP | 4.10 |
| TPSA | 355.76 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.83 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |