C68H90Br2N4O2Zn — CID 56954153
zinc 5,15-bis[3-(8-bromooctoxy)phenyl]-2,8,12,18-tetrabutyl-3,7,13,17-tetramethylporphyrin-22,24-diide (PubChem CID 56954153) has the molecular formula C68H90Br2N4O2Zn and a molecular weight of 1220.69 g/mol. Its IUPAC name is zinc 5,15-bis[3-(8-bromooctoxy)phenyl]-2,8,12,18-tetrabutyl-3,7,13,17-tetramethylporphyrin-22,24-diide.
| Compound Name | zinc 5,15-bis[3-(8-bromooctoxy)phenyl]-2,8,12,18-tetrabutyl-3,7,13,17-tetramethylporphyrin-22,24-diide |
|---|---|
| PubChem CID | 56954153 |
| Molecular Formula | C68H90Br2N4O2Zn |
| Molecular Weight | 1220.69 g/mol |
| Exact Mass | 1216.47 |
| IUPAC Name | zinc 5,15-bis[3-(8-bromooctoxy)phenyl]-2,8,12,18-tetrabutyl-3,7,13,17-tetramethylporphyrin-22,24-diide |
| SMILES | CCCCC1=C(C)c2nc1cc1[n-]c(c(C)c1CCCC)c(-c1cccc(OCCCCCCCCBr)c1)c1nc(cc3[n-]c(c(C)c3CCCC)c2-c2cccc(OCCCCCCCCBr)c2)C(CCCC)=C1C.[Zn+2] |
| InChI | InChI=1S/C68H90Br2N4O2.Zn/c1-9-13-35-55-47(5)65-63(51-31-29-33-53(43-51)75-41-27-23-19-17-21-25-39-69)66-49(7)57(37-15-11-3)61(73-66)46-62-58(38-16-12-4)50(8)68(74-62)64(67-48(6)56(36-14-10-2)60(72-67)45-59(55)71-65)52-32-30-34-54(44-52)76-42-28-24-20-18-22-26-40-70;/h29-34,43-46H,9-28,35-42H2,1-8H3;/q-2;+2/b59-45-,60-45-,61-46-,62-46-,65-63-,66-63-,67-64-,68-64-; |
| InChIKey | DXETXQKJYBCPDS-SFJKGPFBSA-N |
| XLogP | 20.68 |
| TPSA | 72.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1220.69 |
| LogP ≤ 5 | 20.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|