C53H59N5Ni — CID 10748034
15-butyl-2,3,7,8,12,13,17,18-octaethyl-10,20-diphenylporphyrin-22,24-diide-5-carbonitrile;nickel(2+) (PubChem CID 10748034) has the molecular formula C53H59N5Ni and a molecular weight of 824.78 g/mol. Its IUPAC name is 15-butyl-2,3,7,8,12,13,17,18-octaethyl-10,20-diphenylporphyrin-22,24-diide-5-carbonitrile;nickel(2+).
| Compound Name | 15-butyl-2,3,7,8,12,13,17,18-octaethyl-10,20-diphenylporphyrin-22,24-diide-5-carbonitrile;nickel(2+) |
|---|---|
| PubChem CID | 10748034 |
| Molecular Formula | C53H59N5Ni |
| Molecular Weight | 824.78 g/mol |
| Exact Mass | 823.41 |
| IUPAC Name | 15-butyl-2,3,7,8,12,13,17,18-octaethyl-10,20-diphenylporphyrin-22,24-diide-5-carbonitrile;nickel(2+) |
| SMILES | CCCCc1c2nc(c(-c3ccccc3)c3[n-]c(c(C#N)c4nc(c(-c5ccccc5)c5[n-]c1c(CC)c5CC)C(CC)=C4CC)c(CC)c3CC)C(CC)=C2CC.[Ni+2] |
| InChI | InChI=1S/C53H59N5.Ni/c1-10-19-30-42-46-34(11-2)38(15-6)50(55-46)44(32-26-22-20-23-27-32)52-40(17-8)36(13-4)48(57-52)43(31-54)49-37(14-5)41(18-9)53(58-49)45(33-28-24-21-25-29-33)51-39(16-7)35(12-3)47(42)56-51;/h20-29H,10-19,30H2,1-9H3;/q-2;+2/b46-42-,47-42-,48-43-,49-43-,50-44-,51-45-,52-44-,53-45-; |
| InChIKey | UMLODSXPQOLTEL-PHJFDPFISA-N |
| XLogP | 13.83 |
| TPSA | 77.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.78 |
| LogP ≤ 5 | 13.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |