C18H17ClN4 — CID 23151572
6-butyl-5-chloro-7-methyl-2-phenyl-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile (PubChem CID 23151572) has the molecular formula C18H17ClN4 and a molecular weight of 324.81 g/mol. Its IUPAC name is 6-butyl-5-chloro-7-methyl-2-phenyl-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile.
| Compound Name | 6-butyl-5-chloro-7-methyl-2-phenyl-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile |
|---|---|
| PubChem CID | 23151572 |
| Molecular Formula | C18H17ClN4 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 6-butyl-5-chloro-7-methyl-2-phenyl-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile |
| SMILES | CCCCc1c(C)c(C#N)c2nc(-c3ccccc3)nn2c1Cl |
| InChI | InChI=1S/C18H17ClN4/c1-3-4-10-14-12(2)15(11-20)18-21-17(22-23(18)16(14)19)13-8-6-5-7-9-13/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | UFIOFCUETWPDRX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|