C16H20N2 — CID 138967628
4-butyl-5,6-dimethyl-2-phenylpyrimidine (PubChem CID 138967628) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 4-butyl-5,6-dimethyl-2-phenylpyrimidine.
| Compound Name | 4-butyl-5,6-dimethyl-2-phenylpyrimidine |
|---|---|
| PubChem CID | 138967628 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 4-butyl-5,6-dimethyl-2-phenylpyrimidine |
| SMILES | CCCCc1nc(-c2ccccc2)nc(C)c1C |
| InChI | InChI=1S/C16H20N2/c1-4-5-11-15-12(2)13(3)17-16(18-15)14-9-7-6-8-10-14/h6-10H,4-5,11H2,1-3H3 |
| InChIKey | MIHHCSFDODAVMG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |