C16H22N2 — CID 14641798
2,3-dibutylquinoxaline (PubChem CID 14641798) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2,3-dibutylquinoxaline.
| Compound Name | 2,3-dibutylquinoxaline |
|---|---|
| PubChem CID | 14641798 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2,3-dibutylquinoxaline |
| SMILES | CCCCc1nc2ccccc2nc1CCCC |
| InChI | InChI=1S/C16H22N2/c1-3-5-9-13-14(10-6-4-2)18-16-12-8-7-11-15(16)17-13/h7-8,11-12H,3-6,9-10H2,1-2H3 |
| InChIKey | BXSMRDQWKHIDKN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |