C24H28N2 — CID 12063039
5-methyl-2,4-bis(4-methylphenyl)-6-pentylpyrimidine (PubChem CID 12063039) has the molecular formula C24H28N2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 5-methyl-2,4-bis(4-methylphenyl)-6-pentylpyrimidine.
| Compound Name | 5-methyl-2,4-bis(4-methylphenyl)-6-pentylpyrimidine |
|---|---|
| PubChem CID | 12063039 |
| Molecular Formula | C24H28N2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 5-methyl-2,4-bis(4-methylphenyl)-6-pentylpyrimidine |
| SMILES | CCCCCc1nc(-c2ccc(C)cc2)nc(-c2ccc(C)cc2)c1C |
| InChI | InChI=1S/C24H28N2/c1-5-6-7-8-22-19(4)23(20-13-9-17(2)10-14-20)26-24(25-22)21-15-11-18(3)12-16-21/h9-16H,5-8H2,1-4H3 |
| InChIKey | NOYXNWMSGIRELL-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|