C37H39N3 — CID 118244537
2,4-bis(2,4-dimethylphenyl)-6-[4-(4-hexylphenyl)phenyl]-1,3,5-triazine (PubChem CID 118244537) has the molecular formula C37H39N3 and a molecular weight of 525.74 g/mol. Its IUPAC name is 2,4-bis(2,4-dimethylphenyl)-6-[4-(4-hexylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(2,4-dimethylphenyl)-6-[4-(4-hexylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 118244537 |
| Molecular Formula | C37H39N3 |
| Molecular Weight | 525.74 g/mol |
| Exact Mass | 525.31 |
| IUPAC Name | 2,4-bis(2,4-dimethylphenyl)-6-[4-(4-hexylphenyl)phenyl]-1,3,5-triazine |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3nc(-c4ccc(C)cc4C)nc(-c4ccc(C)cc4C)n3)cc2)cc1 |
| InChI | InChI=1S/C37H39N3/c1-6-7-8-9-10-29-13-15-30(16-14-29)31-17-19-32(20-18-31)35-38-36(33-21-11-25(2)23-27(33)4)40-37(39-35)34-22-12-26(3)24-28(34)5/h11-24H,6-10H2,1-5H3 |
| InChIKey | BSFMCLQSLIJXDF-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.74 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|