C61H71N3 — CID 90192426
2-[4-[4-[4-(3,4-dimethylphenyl)-2,5-dihexylphenyl]-2-methylphenyl]phenyl]-4-(4-hexylphenyl)-6-(4-methylphenyl)-1,3,5-triazine (PubChem CID 90192426) has the molecular formula C61H71N3 and a molecular weight of 846.26 g/mol. Its IUPAC name is 2-[4-[4-[4-(3,4-dimethylphenyl)-2,5-dihexylphenyl]-2-methylphenyl]phenyl]-4-(4-hexylphenyl)-6-(4-methylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-[4-[4-(3,4-dimethylphenyl)-2,5-dihexylphenyl]-2-methylphenyl]phenyl]-4-(4-hexylphenyl)-6-(4-methylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 90192426 |
| Molecular Formula | C61H71N3 |
| Molecular Weight | 846.26 g/mol |
| Exact Mass | 845.56 |
| IUPAC Name | 2-[4-[4-[4-(3,4-dimethylphenyl)-2,5-dihexylphenyl]-2-methylphenyl]phenyl]-4-(4-hexylphenyl)-6-(4-methylphenyl)-1,3,5-triazine |
| SMILES | CCCCCCc1ccc(-c2nc(-c3ccc(C)cc3)nc(-c3ccc(-c4ccc(-c5cc(CCCCCC)c(-c6ccc(C)c(C)c6)cc5CCCCCC)cc4C)cc3)n2)cc1 |
| InChI | InChI=1S/C61H71N3/c1-8-11-14-17-20-47-26-31-50(32-27-47)60-62-59(49-28-23-43(4)24-29-49)63-61(64-60)51-35-33-48(34-36-51)56-38-37-55(40-46(56)7)58-42-52(21-18-15-12-9-2)57(41-53(58)22-19-16-13-10-3)54-30-25-44(5)45(6)39-54/h23-42H,8-22H2,1-7H3 |
| InChIKey | ULJDNSXNSGLCOP-UHFFFAOYSA-N |
| XLogP | 17.48 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.26 |
| LogP ≤ 5 | 17.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|