C29H33N5 — CID 118119401
2,4-bis(4,5-dimethyl-2-pyridinyl)-6-(4-hexylphenyl)-1,3,5-triazine (PubChem CID 118119401) has the molecular formula C29H33N5 and a molecular weight of 451.62 g/mol. Its IUPAC name is 2,4-bis(4,5-dimethyl-2-pyridinyl)-6-(4-hexylphenyl)-1,3,5-triazine.
| Compound Name | 2,4-bis(4,5-dimethyl-2-pyridinyl)-6-(4-hexylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 118119401 |
| Molecular Formula | C29H33N5 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | 2,4-bis(4,5-dimethyl-2-pyridinyl)-6-(4-hexylphenyl)-1,3,5-triazine |
| SMILES | CCCCCCc1ccc(-c2nc(-c3cc(C)c(C)cn3)nc(-c3cc(C)c(C)cn3)n2)cc1 |
| InChI | InChI=1S/C29H33N5/c1-6-7-8-9-10-23-11-13-24(14-12-23)27-32-28(25-15-19(2)21(4)17-30-25)34-29(33-27)26-16-20(3)22(5)18-31-26/h11-18H,6-10H2,1-5H3 |
| InChIKey | XBJCIPNNOGOIBQ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|