C39H51N3 — CID 118119391
2-(3,5-dihexylphenyl)-4,6-bis(2,4,5-trimethylphenyl)-1,3,5-triazine (PubChem CID 118119391) has the molecular formula C39H51N3 and a molecular weight of 561.86 g/mol. Its IUPAC name is 2-(3,5-dihexylphenyl)-4,6-bis(2,4,5-trimethylphenyl)-1,3,5-triazine.
| Compound Name | 2-(3,5-dihexylphenyl)-4,6-bis(2,4,5-trimethylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 118119391 |
| Molecular Formula | C39H51N3 |
| Molecular Weight | 561.86 g/mol |
| Exact Mass | 561.41 |
| IUPAC Name | 2-(3,5-dihexylphenyl)-4,6-bis(2,4,5-trimethylphenyl)-1,3,5-triazine |
| SMILES | CCCCCCc1cc(CCCCCC)cc(-c2nc(-c3cc(C)c(C)cc3C)nc(-c3cc(C)c(C)cc3C)n2)c1 |
| InChI | InChI=1S/C39H51N3/c1-9-11-13-15-17-32-23-33(18-16-14-12-10-2)25-34(24-32)37-40-38(35-21-28(5)26(3)19-30(35)7)42-39(41-37)36-22-29(6)27(4)20-31(36)8/h19-25H,9-18H2,1-8H3 |
| InChIKey | UPBNNVBKBVUKOB-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.86 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|