C60H68N4 — CID 140867007
4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-1-[3-[3-(3,5-dioctylphenyl)phenyl]phenyl]-5,6,7,8-tetrahydroisoquinoline (PubChem CID 140867007) has the molecular formula C60H68N4 and a molecular weight of 845.23 g/mol. Its IUPAC name is 4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-1-[3-[3-(3,5-dioctylphenyl)phenyl]phenyl]-5,6,7,8-tetrahydroisoquinoline.
| Compound Name | 4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-1-[3-[3-(3,5-dioctylphenyl)phenyl]phenyl]-5,6,7,8-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 140867007 |
| Molecular Formula | C60H68N4 |
| Molecular Weight | 845.23 g/mol |
| Exact Mass | 844.54 |
| IUPAC Name | 4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-1-[3-[3-(3,5-dioctylphenyl)phenyl]phenyl]-5,6,7,8-tetrahydroisoquinoline |
| SMILES | CCCCCCCCc1cc(CCCCCCCC)cc(-c2cccc(-c3cccc(-c4ncc(-c5nc(-c6ccc(C)cc6)nc(-c6ccc(C)cc6)n5)c5c4CCCC5)c3)c2)c1 |
| InChI | InChI=1S/C60H68N4/c1-5-7-9-11-13-15-21-45-37-46(22-16-14-12-10-8-6-2)39-53(38-45)51-25-19-23-49(40-51)50-24-20-26-52(41-50)57-55-28-18-17-27-54(55)56(42-61-57)60-63-58(47-33-29-43(3)30-34-47)62-59(64-60)48-35-31-44(4)32-36-48/h19-20,23-26,29-42H,5-18,21-22,27-28H2,1-4H3 |
| InChIKey | PBMSKENEHNYXIQ-UHFFFAOYSA-N |
| XLogP | 16.57 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.23 |
| LogP ≤ 5 | 16.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|