C44H44N2 — CID 59194506
5-[3,5-bis[3-(4-methylphenyl)phenyl]phenyl]-2-octylpyrimidine (PubChem CID 59194506) has the molecular formula C44H44N2 and a molecular weight of 600.85 g/mol. Its IUPAC name is 5-[3,5-bis[3-(4-methylphenyl)phenyl]phenyl]-2-octylpyrimidine.
| Compound Name | 5-[3,5-bis[3-(4-methylphenyl)phenyl]phenyl]-2-octylpyrimidine |
|---|---|
| PubChem CID | 59194506 |
| Molecular Formula | C44H44N2 |
| Molecular Weight | 600.85 g/mol |
| Exact Mass | 600.35 |
| IUPAC Name | 5-[3,5-bis[3-(4-methylphenyl)phenyl]phenyl]-2-octylpyrimidine |
| SMILES | CCCCCCCCc1ncc(-c2cc(-c3cccc(-c4ccc(C)cc4)c3)cc(-c3cccc(-c4ccc(C)cc4)c3)c2)cn1 |
| InChI | InChI=1S/C44H44N2/c1-4-5-6-7-8-9-16-44-45-30-43(31-46-44)42-28-40(38-14-10-12-36(25-38)34-21-17-32(2)18-22-34)27-41(29-42)39-15-11-13-37(26-39)35-23-19-33(3)20-24-35/h10-15,17-31H,4-9,16H2,1-3H3 |
| InChIKey | HBMFVVJWAYRJIW-UHFFFAOYSA-N |
| XLogP | 12.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.85 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|