C47H48 — CID 59546699
1-[3-[4-[4-[3-(3,5-dimethylphenyl)phenyl]phenyl]-3-heptylphenyl]phenyl]-3,5-dimethylbenzene (PubChem CID 59546699) has the molecular formula C47H48 and a molecular weight of 612.90 g/mol. Its IUPAC name is 1-[3-[4-[4-[3-(3,5-dimethylphenyl)phenyl]phenyl]-3-heptylphenyl]phenyl]-3,5-dimethylbenzene.
| Compound Name | 1-[3-[4-[4-[3-(3,5-dimethylphenyl)phenyl]phenyl]-3-heptylphenyl]phenyl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 59546699 |
| Molecular Formula | C47H48 |
| Molecular Weight | 612.90 g/mol |
| Exact Mass | 612.38 |
| IUPAC Name | 1-[3-[4-[4-[3-(3,5-dimethylphenyl)phenyl]phenyl]-3-heptylphenyl]phenyl]-3,5-dimethylbenzene |
| SMILES | CCCCCCCc1cc(-c2cccc(-c3cc(C)cc(C)c3)c2)ccc1-c1ccc(-c2cccc(-c3cc(C)cc(C)c3)c2)cc1 |
| InChI | InChI=1S/C47H48/c1-6-7-8-9-10-13-44-32-43(40-15-12-17-42(31-40)46-28-35(4)25-36(5)29-46)22-23-47(44)38-20-18-37(19-21-38)39-14-11-16-41(30-39)45-26-33(2)24-34(3)27-45/h11-12,14-32H,6-10,13H2,1-5H3 |
| InChIKey | AGZPTAPKIAIEHP-UHFFFAOYSA-N |
| XLogP | 13.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.90 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|