C42H53N3 — CID 121461293
1-[2-(8-azidooctyl)-4-(4-methylphenyl)phenyl]-4-(4-methylphenyl)-2-octylbenzene (PubChem CID 121461293) has the molecular formula C42H53N3 and a molecular weight of 599.91 g/mol. Its IUPAC name is 1-[2-(8-azidooctyl)-4-(4-methylphenyl)phenyl]-4-(4-methylphenyl)-2-octylbenzene.
| Compound Name | 1-[2-(8-azidooctyl)-4-(4-methylphenyl)phenyl]-4-(4-methylphenyl)-2-octylbenzene |
|---|---|
| PubChem CID | 121461293 |
| Molecular Formula | C42H53N3 |
| Molecular Weight | 599.91 g/mol |
| Exact Mass | 599.42 |
| IUPAC Name | 1-[2-(8-azidooctyl)-4-(4-methylphenyl)phenyl]-4-(4-methylphenyl)-2-octylbenzene |
| SMILES | CCCCCCCCc1cc(-c2ccc(C)cc2)ccc1-c1ccc(-c2ccc(C)cc2)cc1CCCCCCCCN=[N+]=[N-] |
| InChI | InChI=1S/C42H53N3/c1-4-5-6-7-10-13-16-39-31-37(35-22-18-33(2)19-23-35)26-28-41(39)42-29-27-38(36-24-20-34(3)21-25-36)32-40(42)17-14-11-8-9-12-15-30-44-45-43/h18-29,31-32H,4-17,30H2,1-3H3 |
| InChIKey | VXYKIFQSPACILZ-UHFFFAOYSA-N |
| XLogP | 13.40 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.91 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|