C27H30FN3O — CID 118135378
4-[4-(4-azidobutyl)phenyl]-1-[4-(butoxymethyl)phenyl]-2-fluorobenzene (PubChem CID 118135378) has the molecular formula C27H30FN3O and a molecular weight of 431.56 g/mol. Its IUPAC name is 4-[4-(4-azidobutyl)phenyl]-1-[4-(butoxymethyl)phenyl]-2-fluorobenzene.
| Compound Name | 4-[4-(4-azidobutyl)phenyl]-1-[4-(butoxymethyl)phenyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 118135378 |
| Molecular Formula | C27H30FN3O |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 4-[4-(4-azidobutyl)phenyl]-1-[4-(butoxymethyl)phenyl]-2-fluorobenzene |
| SMILES | CCCCOCc1ccc(-c2ccc(-c3ccc(CCCCN=[N+]=[N-])cc3)cc2F)cc1 |
| InChI | InChI=1S/C27H30FN3O/c1-2-3-18-32-20-22-9-13-24(14-10-22)26-16-15-25(19-27(26)28)23-11-7-21(8-12-23)6-4-5-17-30-31-29/h7-16,19H,2-6,17-18,20H2,1H3 |
| InChIKey | MJXOQPKARBUIOD-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|