C46H52N6O2 — CID 70149004
4-[3-[18-[3-(4-aminophenoxy)propyl]-8,13-diethyl-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propoxy]aniline (PubChem CID 70149004) has the molecular formula C46H52N6O2 and a molecular weight of 720.96 g/mol. Its IUPAC name is 4-[3-[18-[3-(4-aminophenoxy)propyl]-8,13-diethyl-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propoxy]aniline.
| Compound Name | 4-[3-[18-[3-(4-aminophenoxy)propyl]-8,13-diethyl-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propoxy]aniline |
|---|---|
| PubChem CID | 70149004 |
| Molecular Formula | C46H52N6O2 |
| Molecular Weight | 720.96 g/mol |
| Exact Mass | 720.42 |
| IUPAC Name | 4-[3-[18-[3-(4-aminophenoxy)propyl]-8,13-diethyl-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propoxy]aniline |
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCCOc1ccc(N)cc1)C(CCCOc1ccc(N)cc1)=C4C)c(C)c3CC |
| InChI | InChI=1S/C46H52N6O2/c1-7-35-27(3)39-23-40-29(5)37(11-9-21-53-33-17-13-31(47)14-18-33)45(51-40)26-46-38(12-10-22-54-34-19-15-32(48)16-20-34)30(6)42(52-46)25-44-36(8-2)28(4)41(50-44)24-43(35)49-39/h13-20,23-26,49-50H,7-12,21-22,47-48H2,1-6H3/b39-23-,40-23-,41-24-,42-25-,43-24-,44-25-,45-26-,46-26- |
| InChIKey | MCPCLNVFDZHTTI-JBMZJBMDSA-N |
| XLogP | 10.80 |
| TPSA | 127.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.96 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|