C42H50N4 — CID 86027740
2,3,7,8,12,13,17,18-octaethyl-23-phenyl-21H-porphyrin (PubChem CID 86027740) has the molecular formula C42H50N4 and a molecular weight of 610.89 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octaethyl-23-phenyl-21H-porphyrin.
| Compound Name | 2,3,7,8,12,13,17,18-octaethyl-23-phenyl-21H-porphyrin |
|---|---|
| PubChem CID | 86027740 |
| Molecular Formula | C42H50N4 |
| Molecular Weight | 610.89 g/mol |
| Exact Mass | 610.40 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octaethyl-23-phenyl-21H-porphyrin |
| SMILES | CCC1=C(CC)c2cc3c(CC)c(CC)c(cc4nc(cc5[nH]c(cc1n2)c(CC)c5CC)C(CC)=C4CC)n3-c1ccccc1 |
| InChI | InChI=1S/C42H50N4/c1-9-27-28(10-2)36-23-38-30(12-4)32(14-6)40(45-38)25-42-34(16-8)33(15-7)41(46(42)26-20-18-17-19-21-26)24-39-31(13-5)29(11-3)37(44-39)22-35(27)43-36/h17-25,43H,9-16H2,1-8H3/b35-22-,36-23-,37-22-,38-23-,39-24-,40-25-,41-24-,42-25- |
| InChIKey | BFTZDKGMWISXEC-QEIQAYOGSA-N |
| XLogP | 11.49 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.89 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |