C39H42N4O — CID 146034824
(Z)-(3,7,12,18-tetraethyl-2,8,13,17-tetramethyl-15-phenyl-23H-porphyrin-5-ylidene)methanol (PubChem CID 146034824) has the molecular formula C39H42N4O and a molecular weight of 582.79 g/mol. Its IUPAC name is (Z)-(3,7,12,18-tetraethyl-2,8,13,17-tetramethyl-15-phenyl-23H-porphyrin-5-ylidene)methanol.
| Compound Name | (Z)-(3,7,12,18-tetraethyl-2,8,13,17-tetramethyl-15-phenyl-23H-porphyrin-5-ylidene)methanol |
|---|---|
| PubChem CID | 146034824 |
| Molecular Formula | C39H42N4O |
| Molecular Weight | 582.79 g/mol |
| Exact Mass | 582.34 |
| IUPAC Name | (Z)-(3,7,12,18-tetraethyl-2,8,13,17-tetramethyl-15-phenyl-23H-porphyrin-5-ylidene)methanol |
| SMILES | CCC1=C(C)/C2=C/C3=N/C(=C(/c4ccccc4)c4[nH]c(c(CC)c4C)/C=C4\N=C(C(CC)=C4C)/C(=C/O)C1=N2)C(C)=C3CC |
| InChI | InChI=1S/C39H42N4O/c1-9-26-23(7)36-35(25-16-14-13-15-17-25)37-24(8)27(10-2)34(43-37)19-32-22(6)29(12-4)39(41-32)30(20-44)38-28(11-3)21(5)31(40-38)18-33(26)42-36/h13-20,42,44H,9-12H2,1-8H3/b30-20-,31-18-,32-19-,37-35- |
| InChIKey | GZUYKQTWEMVZDE-VKWCNTCLSA-N |
| XLogP | 9.87 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.79 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|