C36H39N5 — CID 102092003
(1Z)-N,N-dimethyl-1-(2,3,7,8,12,13,17,18-octamethyl-10-phenyl-23,24-dihydrocorrin-5-ylidene)methanamine (PubChem CID 102092003) has the molecular formula C36H39N5 and a molecular weight of 541.74 g/mol. Its IUPAC name is (1Z)-N,N-dimethyl-1-(2,3,7,8,12,13,17,18-octamethyl-10-phenyl-23,24-dihydrocorrin-5-ylidene)methanamine.
| Compound Name | (1Z)-N,N-dimethyl-1-(2,3,7,8,12,13,17,18-octamethyl-10-phenyl-23,24-dihydrocorrin-5-ylidene)methanamine |
|---|---|
| PubChem CID | 102092003 |
| Molecular Formula | C36H39N5 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | (1Z)-N,N-dimethyl-1-(2,3,7,8,12,13,17,18-octamethyl-10-phenyl-23,24-dihydrocorrin-5-ylidene)methanamine |
| SMILES | CC1=C(C)/C2=C(\c3ccccc3)c3[nH]c(c(C)c3C)/C=c3\[nH]/c(c(C)c3C)=C3\N=C(C(C)=C3C)/C(=C\N(C)C)C1=N2 |
| InChI | InChI=1S/C36H39N5/c1-18-20(3)33-30(26-14-12-11-13-15-26)34-24(7)22(5)31(39-34)27(17-41(9)10)32-23(6)25(8)36(40-32)35-21(4)19(2)29(38-35)16-28(18)37-33/h11-17,37-38H,1-10H3/b27-17-,29-16-,34-30-,36-35- |
| InChIKey | YYWDWIDMNBOCBZ-YZNQULBDSA-N |
| XLogP | 6.31 |
| TPSA | 59.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |