C36H46N4O2 — CID 177445940
(1Z,9Z)-15-tert-butyl-3,7,12,18-tetraethyl-15-hydroxy-2,8,13,17-tetramethyl-23,24-dihydroporphyrin-5-one (PubChem CID 177445940) has the molecular formula C36H46N4O2 and a molecular weight of 566.79 g/mol. Its IUPAC name is (1Z,9Z)-15-tert-butyl-3,7,12,18-tetraethyl-15-hydroxy-2,8,13,17-tetramethyl-23,24-dihydroporphyrin-5-one.
| Compound Name | (1Z,9Z)-15-tert-butyl-3,7,12,18-tetraethyl-15-hydroxy-2,8,13,17-tetramethyl-23,24-dihydroporphyrin-5-one |
|---|---|
| PubChem CID | 177445940 |
| Molecular Formula | C36H46N4O2 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.36 |
| IUPAC Name | (1Z,9Z)-15-tert-butyl-3,7,12,18-tetraethyl-15-hydroxy-2,8,13,17-tetramethyl-23,24-dihydroporphyrin-5-one |
| SMILES | CCC1=C(C)/C2=C/c3[nH]c(c(C)c3CC)C(O)(C(C)(C)C)c3[nH]c(c(CC)c3C)/C=C3\N=C(C(=O)C1=N2)C(CC)=C3C |
| InChI | InChI=1S/C36H46N4O2/c1-12-22-20(7)33-36(42,35(9,10)11)34-21(8)23(13-2)29(40-34)17-27-19(6)25(15-4)31(38-27)32(41)30-24(14-3)18(5)26(37-30)16-28(22)39-33/h16-17,39-40,42H,12-15H2,1-11H3/b26-16-,27-17- |
| InChIKey | NACXFWFLVCJLGJ-OTMNIUQESA-N |
| XLogP | 7.99 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |