C32H35N3O — CID 135746139
(Z)-(10,14,15,19-tetraethyl-9,20-dimethyl-21,22,23-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),5,7,9,11(23),12,14,16,18(21),19-undecaen-4-ylidene)methanol (PubChem CID 135746139) has the molecular formula C32H35N3O and a molecular weight of 477.65 g/mol. Its IUPAC name is (Z)-(10,14,15,19-tetraethyl-9,20-dimethyl-21,22,23-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),5,7,9,11(23),12,14,16,18(21),19-undecaen-4-ylidene)methanol.
| Compound Name | (Z)-(10,14,15,19-tetraethyl-9,20-dimethyl-21,22,23-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),5,7,9,11(23),12,14,16,18(21),19-undecaen-4-ylidene)methanol |
|---|---|
| PubChem CID | 135746139 |
| Molecular Formula | C32H35N3O |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | (Z)-(10,14,15,19-tetraethyl-9,20-dimethyl-21,22,23-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),5,7,9,11(23),12,14,16,18(21),19-undecaen-4-ylidene)methanol |
| SMILES | CCC1=C(C)/C2=C/C3=C/C(=C/O)C(=C3)/C=C3\N=C(/C=c4\[nH]/c(c(CC)c4CC)=C\C1=N2)C(CC)=C3C |
| InChI | InChI=1S/C32H35N3O/c1-7-23-18(5)27-13-20-11-21(22(12-20)17-36)14-28-19(6)24(8-2)30(34-28)16-32-26(10-4)25(9-3)31(35-32)15-29(23)33-27/h11-17,35-36H,7-10H2,1-6H3/b22-17-,27-13-,28-14-,31-15-,32-16- |
| InChIKey | OFUSZCUXMHEGGI-MUDGIYOCSA-N |
| XLogP | 6.15 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|