C42H52N4 — CID 177476952
(10Z,15Z,19Z)-2,3,7,8,12,13,17,18-octaethyl-22-phenyl-21,24-dihydro-5H-porphyrin (PubChem CID 177476952) has the molecular formula C42H52N4 and a molecular weight of 612.91 g/mol. Its IUPAC name is (10Z,15Z,19Z)-2,3,7,8,12,13,17,18-octaethyl-22-phenyl-21,24-dihydro-5H-porphyrin.
| Compound Name | (10Z,15Z,19Z)-2,3,7,8,12,13,17,18-octaethyl-22-phenyl-21,24-dihydro-5H-porphyrin |
|---|---|
| PubChem CID | 177476952 |
| Molecular Formula | C42H52N4 |
| Molecular Weight | 612.91 g/mol |
| Exact Mass | 612.42 |
| IUPAC Name | (10Z,15Z,19Z)-2,3,7,8,12,13,17,18-octaethyl-22-phenyl-21,24-dihydro-5H-porphyrin |
| SMILES | CCC1=C(CC)/C2=C/c3c(CC)c(CC)c(n3-c3ccccc3)Cc3[nH]c(c(CC)c3CC)/C=c3\[nH]/c(c(CC)c3CC)=C\C1=N2 |
| InChI | InChI=1S/C42H52N4/c1-9-27-28(10-2)36-23-38-30(12-4)32(14-6)40(45-38)25-42-34(16-8)33(15-7)41(46(42)26-20-18-17-19-21-26)24-39-31(13-5)29(11-3)37(44-39)22-35(27)43-36/h17-24,43,45H,9-16,25H2,1-8H3/b35-22-,36-23-,39-24- |
| InChIKey | HCUJJNOWDLJUDR-OCROVDCQSA-N |
| XLogP | 8.63 |
| TPSA | 48.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.91 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |