C33H42N4Pt — CID 143829005
platinum;(4Z,10Z,15Z,19Z)-2,7,12,17-tetraethyl-3,8,13,18,21-pentamethyl-22,24-dihydro-1H-porphyrin (PubChem CID 143829005) has the molecular formula C33H42N4Pt and a molecular weight of 689.81 g/mol. Its IUPAC name is platinum;(4Z,10Z,15Z,19Z)-2,7,12,17-tetraethyl-3,8,13,18,21-pentamethyl-22,24-dihydro-1H-porphyrin.
| Compound Name | platinum;(4Z,10Z,15Z,19Z)-2,7,12,17-tetraethyl-3,8,13,18,21-pentamethyl-22,24-dihydro-1H-porphyrin |
|---|---|
| PubChem CID | 143829005 |
| Molecular Formula | C33H42N4Pt |
| Molecular Weight | 689.81 g/mol |
| Exact Mass | 689.31 |
| IUPAC Name | platinum;(4Z,10Z,15Z,19Z)-2,7,12,17-tetraethyl-3,8,13,18,21-pentamethyl-22,24-dihydro-1H-porphyrin |
| SMILES | CCC1=C(C)C2=N/C1=C\c1[nH]c(c(CC)c1C)/C=C1/C(C)=C(CC)C(/C=c3\[nH]/c(c(CC)c3C)=C\2)N1C.[Pt] |
| InChI | InChI=1S/C33H42N4.Pt/c1-10-22-18(5)26-14-30-23(11-2)20(7)28(36-30)16-33-25(13-4)21(8)32(37(33)9)17-31-24(12-3)19(6)27(35-31)15-29(22)34-26;/h14-17,33,35-36H,10-13H2,1-9H3;/b28-16-,29-15-,30-14-,32-17-; |
| InChIKey | QNZAFIDLLRHRSL-SBHSRHCASA-N |
| XLogP | 6.26 |
| TPSA | 47.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.81 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |