C32H36N4O4 — CID 54426326
18-(2-carboxyethyl)-7,12-diethyl-3,8,13,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-carboxylic acid (PubChem CID 54426326) has the molecular formula C32H36N4O4 and a molecular weight of 540.66 g/mol. Its IUPAC name is 18-(2-carboxyethyl)-7,12-diethyl-3,8,13,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-carboxylic acid.
| Compound Name | 18-(2-carboxyethyl)-7,12-diethyl-3,8,13,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-carboxylic acid |
|---|---|
| PubChem CID | 54426326 |
| Molecular Formula | C32H36N4O4 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 18-(2-carboxyethyl)-7,12-diethyl-3,8,13,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-carboxylic acid |
| SMILES | CCc1c2[nH]c(c1C)C=c1[nH]c(c(CCC(=O)O)c1C)=Cc1[nH]c(c(C)c1C(=O)O)C=c1[nH]c(c(C)c1CC)=C2 |
| InChI | InChI=1S/C32H36N4O4/c1-7-19-15(3)22-11-23-17(5)21(9-10-30(37)38)28(35-23)14-29-31(32(39)40)18(6)25(36-29)13-27-20(8-2)16(4)24(34-27)12-26(19)33-22/h11-14,33-36H,7-10H2,1-6H3,(H,37,38)(H,39,40) |
| InChIKey | QFUROPGKWRTSBV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 137.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |