C34H38N4O4 — CID 6914019
3-[(1Z,4Z,10Z,14Z)-18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-12,13,21,22,23,24-hexahydroporphyrin-2-yl]propanoic acid (PubChem CID 6914019) has the molecular formula C34H38N4O4 and a molecular weight of 566.70 g/mol. Its IUPAC name is 3-[(1Z,4Z,10Z,14Z)-18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-12,13,21,22,23,24-hexahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[(1Z,4Z,10Z,14Z)-18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-12,13,21,22,23,24-hexahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 6914019 |
| Molecular Formula | C34H38N4O4 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | 3-[(1Z,4Z,10Z,14Z)-18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-12,13,21,22,23,24-hexahydroporphyrin-2-yl]propanoic acid |
| SMILES | C=Cc1c2[nH]c(c1C)/C=C1\N/C(=C\c3[nH]c(c(CCC(=O)O)c3C)/C=c3\[nH]/c(c(C)c3CCC(=O)O)=C\2)C(C)C1C=C |
| InChI | InChI=1S/C34H38N4O4/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25/h7-8,13-17,21,35-38H,1-2,9-12H2,3-6H3,(H,39,40)(H,41,42)/b25-13-,28-15-,29-14-,32-16- |
| InChIKey | XYIPGGLPOMLCAI-RQMPPGGTSA-N |
| XLogP | 4.67 |
| TPSA | 134.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|