C38H44N4O4 — CID 6852453
ethyl 3-[(1Z,4Z,10Z,14Z)-7,12-bis(ethenyl)-18-(3-ethoxy-3-oxopropyl)-3,8,13,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate (PubChem CID 6852453) has the molecular formula C38H44N4O4 and a molecular weight of 620.79 g/mol. Its IUPAC name is ethyl 3-[(1Z,4Z,10Z,14Z)-7,12-bis(ethenyl)-18-(3-ethoxy-3-oxopropyl)-3,8,13,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate.
| Compound Name | ethyl 3-[(1Z,4Z,10Z,14Z)-7,12-bis(ethenyl)-18-(3-ethoxy-3-oxopropyl)-3,8,13,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 6852453 |
| Molecular Formula | C38H44N4O4 |
| Molecular Weight | 620.79 g/mol |
| Exact Mass | 620.34 |
| IUPAC Name | ethyl 3-[(1Z,4Z,10Z,14Z)-7,12-bis(ethenyl)-18-(3-ethoxy-3-oxopropyl)-3,8,13,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate |
| SMILES | C=Cc1c2[nH]c(c1C)/C=c1\[nH]/c(c(C)c1C=C)=C\c1[nH]c(c(CCC(=O)OCC)c1C)/C=c1\[nH]/c(c(C)c1CCC(=O)OCC)=C\2 |
| InChI | InChI=1S/C38H44N4O4/c1-9-25-21(5)29-17-30-23(7)27(13-15-37(43)45-11-3)35(41-30)20-36-28(14-16-38(44)46-12-4)24(8)32(42-36)19-34-26(10-2)22(6)31(40-34)18-33(25)39-29/h9-10,17-20,39-42H,1-2,11-16H2,3-8H3/b29-17-,30-17-,31-18-,32-19-,33-18-,34-19-,35-20-,36-20- |
| InChIKey | UPYVEHWJYFKNJX-LHPWBCDESA-N |
| XLogP | 4.14 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.79 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |