C37H42N4O4 — CID 91284067
methyl 3-[8-cyclopropyl-13-ethenyl-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate (PubChem CID 91284067) has the molecular formula C37H42N4O4 and a molecular weight of 606.77 g/mol. Its IUPAC name is methyl 3-[8-cyclopropyl-13-ethenyl-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[8-cyclopropyl-13-ethenyl-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 91284067 |
| Molecular Formula | C37H42N4O4 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | methyl 3-[8-cyclopropyl-13-ethenyl-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate |
| SMILES | C=Cc1c(C)c2[nH]c1=Cc1[nH]c(c(CCC(=O)OC)c1C)C=c1[nH]c(c(C)c1CCC(=O)OC)=Cc1[nH]c(c(C3CC3)c1C)C=2 |
| InChI | InChI=1S/C37H42N4O4/c1-8-24-19(2)29-17-34-37(23-9-10-23)22(5)30(41-34)15-27-20(3)25(11-13-35(42)44-6)32(39-27)18-33-26(12-14-36(43)45-7)21(4)28(40-33)16-31(24)38-29/h8,15-18,23,38-41H,1,9-14H2,2-7H3 |
| InChIKey | IYBOCUNDDFTZQD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |