C46H52N6O4+2 — CID 57221166
methyl 3-[18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-8,13-bis(2-pyridin-1-ium-1-ylethyl)-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate (PubChem CID 57221166) has the molecular formula C46H52N6O4+2 and a molecular weight of 752.96 g/mol. Its IUPAC name is methyl 3-[18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-8,13-bis(2-pyridin-1-ium-1-ylethyl)-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-8,13-bis(2-pyridin-1-ium-1-ylethyl)-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 57221166 |
| Molecular Formula | C46H52N6O4+2 |
| Molecular Weight | 752.96 g/mol |
| Exact Mass | 752.40 |
| IUPAC Name | methyl 3-[18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-8,13-bis(2-pyridin-1-ium-1-ylethyl)-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate |
| SMILES | COC(=O)CCc1c2[nH]c(c1C)C=c1[nH]c(c(C)c1CC[n+]1ccccc1)=Cc1[nH]c(c(C)c1CC[n+]1ccccc1)C=c1[nH]c(c(CCC(=O)OC)c1C)=C2 |
| InChI | InChI=1S/C46H52N6O4/c1-29-33(13-15-45(53)55-5)43-28-44-34(14-16-46(54)56-6)30(2)39(50-44)26-42-36(18-24-52-21-11-8-12-22-52)32(4)40(49-42)27-41-35(17-23-51-19-9-7-10-20-51)31(3)38(47-41)25-37(29)48-43/h7-12,19-22,25-28,47-50H,13-18,23-24H2,1-6H3/q+2 |
| InChIKey | BNWRTBAWVCPPDW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.96 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|