C37H44N4O2 — CID 91552377
4-[7-ethenyl-3,8,13,17-tetramethyl-18-(3-oxobutyl)-12-propyl-21,22,23,24-tetrahydroporphyrin-2-yl]butan-2-one (PubChem CID 91552377) has the molecular formula C37H44N4O2 and a molecular weight of 576.79 g/mol. Its IUPAC name is 4-[7-ethenyl-3,8,13,17-tetramethyl-18-(3-oxobutyl)-12-propyl-21,22,23,24-tetrahydroporphyrin-2-yl]butan-2-one.
| Compound Name | 4-[7-ethenyl-3,8,13,17-tetramethyl-18-(3-oxobutyl)-12-propyl-21,22,23,24-tetrahydroporphyrin-2-yl]butan-2-one |
|---|---|
| PubChem CID | 91552377 |
| Molecular Formula | C37H44N4O2 |
| Molecular Weight | 576.79 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | 4-[7-ethenyl-3,8,13,17-tetramethyl-18-(3-oxobutyl)-12-propyl-21,22,23,24-tetrahydroporphyrin-2-yl]butan-2-one |
| SMILES | C=Cc1c2[nH]c(c1C)C=c1[nH]c(c(C)c1CCC)=Cc1[nH]c(c(CCC(C)=O)c1C)C=c1[nH]c(c(C)c1CCC(C)=O)=C2 |
| InChI | InChI=1S/C37H44N4O2/c1-9-11-27-23(6)30-16-31-24(7)28(14-12-20(3)42)36(40-31)19-37-29(15-13-21(4)43)25(8)33(41-37)17-34-26(10-2)22(5)32(38-34)18-35(27)39-30/h10,16-19,38-41H,2,9,11-15H2,1,3-8H3 |
| InChIKey | JTKQJXBFPUOJIG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.79 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |