C34H38Br2N4 — CID 54105715
2,18-bis(3-bromopropyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-21,22,23,24-tetrahydroporphyrin (PubChem CID 54105715) has the molecular formula C34H38Br2N4 and a molecular weight of 662.51 g/mol. Its IUPAC name is 2,18-bis(3-bromopropyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 2,18-bis(3-bromopropyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 54105715 |
| Molecular Formula | C34H38Br2N4 |
| Molecular Weight | 662.51 g/mol |
| Exact Mass | 660.15 |
| IUPAC Name | 2,18-bis(3-bromopropyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-21,22,23,24-tetrahydroporphyrin |
| SMILES | C=Cc1c2[nH]c(c1C)C=c1[nH]c(c(CCCBr)c1C)=Cc1[nH]c(c(C)c1CCCBr)C=c1[nH]c(c(C)c1C=C)=C2 |
| InChI | InChI=1S/C34H38Br2N4/c1-7-23-19(3)27-15-28-21(5)25(11-9-13-35)33(39-28)18-34-26(12-10-14-36)22(6)30(40-34)17-32-24(8-2)20(4)29(38-32)16-31(23)37-27/h7-8,15-18,37-40H,1-2,9-14H2,3-6H3 |
| InChIKey | HXUNKGKFTQRKEU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|