C34H34N4O4 — CID 54698040
3-[(1Z,4Z)-18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12-trimethyl-17-methylidene-22,23-dihydro-21H-porphyrin-2-yl]propanoic acid (PubChem CID 54698040) has the molecular formula C34H34N4O4 and a molecular weight of 562.67 g/mol. Its IUPAC name is 3-[(1Z,4Z)-18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12-trimethyl-17-methylidene-22,23-dihydro-21H-porphyrin-2-yl]propanoic acid.
| Compound Name | 3-[(1Z,4Z)-18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12-trimethyl-17-methylidene-22,23-dihydro-21H-porphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 54698040 |
| Molecular Formula | C34H34N4O4 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | 3-[(1Z,4Z)-18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12-trimethyl-17-methylidene-22,23-dihydro-21H-porphyrin-2-yl]propanoic acid |
| SMILES | C=Cc1c2[nH]c(c1C)/C=c1\[nH]/c(c(CCC(=O)O)c1C)=C\C1=C(CCC(=O)O)C(=C)C(=N1)C=c1[nH]c(c(C)c1C=C)=C2 |
| InChI | InChI=1S/C34H34N4O4/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25/h7-8,13-16,35-37H,1-2,6,9-12H2,3-5H3,(H,39,40)(H,41,42)/b26-13-,27-14?,30-15?,31-16- |
| InChIKey | PMHQKOGCQWAOQP-VGYCGYFESA-N |
| XLogP | 3.26 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |