C36H40N4O5 — CID 54171118
3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-22-(2-hydroxyethyl)-3,7,12,17-tetramethyl-23,24-dihydro-21H-porphyrin-2-yl]propanoic acid (PubChem CID 54171118) has the molecular formula C36H40N4O5 and a molecular weight of 608.74 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-22-(2-hydroxyethyl)-3,7,12,17-tetramethyl-23,24-dihydro-21H-porphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-22-(2-hydroxyethyl)-3,7,12,17-tetramethyl-23,24-dihydro-21H-porphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 54171118 |
| Molecular Formula | C36H40N4O5 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-22-(2-hydroxyethyl)-3,7,12,17-tetramethyl-23,24-dihydro-21H-porphyrin-2-yl]propanoic acid |
| SMILES | C=Cc1c(C)c2n(CCO)c1C=c1[nH]c(c(C=C)c1C)=Cc1[nH]c(c(CCC(=O)O)c1C)C=c1[nH]c(c(C)c1CCC(=O)O)=C2 |
| InChI | InChI=1S/C36H40N4O5/c1-7-23-19(3)29-18-34-24(8-2)22(6)33(40(34)13-14-41)17-28-21(5)26(10-12-36(44)45)32(39-28)16-31-25(9-11-35(42)43)20(4)27(37-31)15-30(23)38-29/h7-8,15-18,37-39,41H,1-2,9-14H2,3-6H3,(H,42,43)(H,44,45) |
| InChIKey | AHILTZVDVPJTOL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 147.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |