C39H43N5O7 — CID 54506271
(4S)-4-amino-5-[13,17-bis(2-carboxyethyl)-2,7-bis(ethenyl)-3,8,12,18-tetramethyl-21,22,23,24-tetrahydroporphyrin-5-yl]-5-oxopentanoic acid (PubChem CID 54506271) has the molecular formula C39H43N5O7 and a molecular weight of 693.80 g/mol. Its IUPAC name is (4S)-4-amino-5-[13,17-bis(2-carboxyethyl)-2,7-bis(ethenyl)-3,8,12,18-tetramethyl-21,22,23,24-tetrahydroporphyrin-5-yl]-5-oxopentanoic acid.
| Compound Name | (4S)-4-amino-5-[13,17-bis(2-carboxyethyl)-2,7-bis(ethenyl)-3,8,12,18-tetramethyl-21,22,23,24-tetrahydroporphyrin-5-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 54506271 |
| Molecular Formula | C39H43N5O7 |
| Molecular Weight | 693.80 g/mol |
| Exact Mass | 693.32 |
| IUPAC Name | (4S)-4-amino-5-[13,17-bis(2-carboxyethyl)-2,7-bis(ethenyl)-3,8,12,18-tetramethyl-21,22,23,24-tetrahydroporphyrin-5-yl]-5-oxopentanoic acid |
| SMILES | C=Cc1c2[nH]c(c1C)C(C(=O)[C@@H](N)CCC(=O)O)=c1[nH]c(c(C)c1C=C)=Cc1[nH]c(c(CCC(=O)O)c1C)C=c1[nH]c(c(C)c1CCC(=O)O)=C2 |
| InChI | InChI=1S/C39H43N5O7/c1-7-22-21(6)37-36(39(51)26(40)11-14-35(49)50)38-23(8-2)18(3)29(43-38)15-27-19(4)24(9-12-33(45)46)31(41-27)17-32-25(10-13-34(47)48)20(5)28(42-32)16-30(22)44-37/h7-8,15-17,26,41-44H,1-2,9-14,40H2,3-6H3,(H,45,46)(H,47,48)(H,49,50)/t26-/m0/s1 |
| InChIKey | TZZMFUFQZGSJAQ-SANMLTNESA-N |
| XLogP | 2.31 |
| TPSA | 218.15 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.80 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 5 |