C37H45N5O6 — CID 54158134
3-[10-[(2S)-2-amino-3-hydroxypropanoyl]-18-(2-carboxyethyl)-7,12-diethyl-3,8,13,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoic acid (PubChem CID 54158134) has the molecular formula C37H45N5O6 and a molecular weight of 655.80 g/mol. Its IUPAC name is 3-[10-[(2S)-2-amino-3-hydroxypropanoyl]-18-(2-carboxyethyl)-7,12-diethyl-3,8,13,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[10-[(2S)-2-amino-3-hydroxypropanoyl]-18-(2-carboxyethyl)-7,12-diethyl-3,8,13,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 54158134 |
| Molecular Formula | C37H45N5O6 |
| Molecular Weight | 655.80 g/mol |
| Exact Mass | 655.34 |
| IUPAC Name | 3-[10-[(2S)-2-amino-3-hydroxypropanoyl]-18-(2-carboxyethyl)-7,12-diethyl-3,8,13,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoic acid |
| SMILES | CCc1c2[nH]c(c1C)C(C(=O)[C@@H](N)CO)=c1[nH]c(c(C)c1CC)=Cc1[nH]c(c(CCC(=O)O)c1C)C=c1[nH]c(c(C)c1CCC(=O)O)=C2 |
| InChI | InChI=1S/C37H45N5O6/c1-7-21-20(6)35-34(37(48)25(38)16-43)36-22(8-2)17(3)28(41-36)13-26-18(4)23(9-11-32(44)45)30(39-26)15-31-24(10-12-33(46)47)19(5)27(40-31)14-29(21)42-35/h13-15,25,39-43H,7-12,16,38H2,1-6H3,(H,44,45)(H,46,47)/t25-/m0/s1 |
| InChIKey | PGBWXWMZQZZVHO-VWLOTQADSA-N |
| XLogP | 1.28 |
| TPSA | 201.08 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.80 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 5 |