C36H44N6O5 — CID 54316732
3-[18-(2-carboxyethyl)-10-(2,2-diaminohexanoyl)-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoic acid (PubChem CID 54316732) has the molecular formula C36H44N6O5 and a molecular weight of 640.79 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-10-(2,2-diaminohexanoyl)-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-(2-carboxyethyl)-10-(2,2-diaminohexanoyl)-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 54316732 |
| Molecular Formula | C36H44N6O5 |
| Molecular Weight | 640.79 g/mol |
| Exact Mass | 640.34 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-10-(2,2-diaminohexanoyl)-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoic acid |
| SMILES | CCCCC(N)(N)C(=O)C1=c2[nH]c(cc2C)=Cc2[nH]c(c(CCC(=O)O)c2C)C=c2[nH]c(c(C)c2CCC(=O)O)=Cc2[nH]c1cc2C |
| InChI | InChI=1S/C36H44N6O5/c1-6-7-12-36(37,38)35(47)33-30-14-18(2)25(40-30)16-27-21(5)24(9-11-32(45)46)29(42-27)17-28-23(8-10-31(43)44)20(4)26(41-28)15-22-13-19(3)34(33)39-22/h13-17,39-42H,6-12,37-38H2,1-5H3,(H,43,44)(H,45,46) |
| InChIKey | SMYSOYVMKJINTG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 206.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.79 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|