C33H37N5O5 — CID 54180451
3-[10-(3-aminopropanoyl)-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoic acid (PubChem CID 54180451) has the molecular formula C33H37N5O5 and a molecular weight of 583.69 g/mol. Its IUPAC name is 3-[10-(3-aminopropanoyl)-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[10-(3-aminopropanoyl)-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 54180451 |
| Molecular Formula | C33H37N5O5 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | 3-[10-(3-aminopropanoyl)-18-(2-carboxyethyl)-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoic acid |
| SMILES | Cc1cc2[nH]c1C=c1[nH]c(c(CCC(=O)O)c1C)=Cc1[nH]c(c(C)c1CCC(=O)O)C=c1cc(C)c([nH]1)=C2C(=O)CCN |
| InChI | InChI=1S/C33H37N5O5/c1-16-12-28-32(29(39)9-10-34)33-17(2)11-20(35-33)13-24-18(3)21(5-7-30(40)41)26(37-24)15-27-22(6-8-31(42)43)19(4)25(38-27)14-23(16)36-28/h11-15,35-38H,5-10,34H2,1-4H3,(H,40,41)(H,42,43) |
| InChIKey | BZBXGJONHIRJSW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 180.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 4 |