C30H34N4O4 — CID 139592329
3-[(1Z,2S,3S,4Z,10Z,14Z)-18-(2-carboxyethyl)-3,8,13,17-tetramethyl-2,3,21,22,23,24-hexahydroporphyrin-2-yl]propanoic acid (PubChem CID 139592329) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is 3-[(1Z,2S,3S,4Z,10Z,14Z)-18-(2-carboxyethyl)-3,8,13,17-tetramethyl-2,3,21,22,23,24-hexahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[(1Z,2S,3S,4Z,10Z,14Z)-18-(2-carboxyethyl)-3,8,13,17-tetramethyl-2,3,21,22,23,24-hexahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 139592329 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 3-[(1Z,2S,3S,4Z,10Z,14Z)-18-(2-carboxyethyl)-3,8,13,17-tetramethyl-2,3,21,22,23,24-hexahydroporphyrin-2-yl]propanoic acid |
| SMILES | Cc1cc2[nH]c1/C=c1/cc(C)/c([nH]1)=C/c1[nH]c(c(CCC(=O)O)c1C)/C=C1\N/C(=C\2)[C@@H](C)[C@@H]1CCC(=O)O |
| InChI | InChI=1S/C30H34N4O4/c1-15-9-20-12-25-17(3)21(5-7-29(35)36)27(33-25)14-28-22(6-8-30(37)38)18(4)26(34-28)13-24-16(2)10-19(32-24)11-23(15)31-20/h9-14,17,21,31-34H,5-8H2,1-4H3,(H,35,36)(H,37,38)/b19-11-,24-13-,25-12-,27-14-/t17-,21-/m0/s1 |
| InChIKey | ZIBKJAOETBNIAV-JUTMBLIMSA-N |
| XLogP | 3.69 |
| TPSA | 134.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |