C33H36N4O6 — CID 90839149
3-[12,17-bis(2-hydroperoxyprop-2-enyl)-3,8,13,18-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoic acid (PubChem CID 90839149) has the molecular formula C33H36N4O6 and a molecular weight of 584.67 g/mol. Its IUPAC name is 3-[12,17-bis(2-hydroperoxyprop-2-enyl)-3,8,13,18-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[12,17-bis(2-hydroperoxyprop-2-enyl)-3,8,13,18-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 90839149 |
| Molecular Formula | C33H36N4O6 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | 3-[12,17-bis(2-hydroperoxyprop-2-enyl)-3,8,13,18-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoic acid |
| SMILES | C=C(Cc1c2[nH]c(c1C)C=c1[nH]c(c(C)c1CCC(=O)O)=Cc1cc(C)c([nH]1)C=c1[nH]c(c(C)c1CC(=C)OO)=C2)OO |
| InChI | InChI=1S/C33H36N4O6/c1-16-9-22-12-27-19(4)23(7-8-33(38)39)30(35-27)14-28-21(6)25(11-18(3)43-41)32(37-28)15-29-20(5)24(10-17(2)42-40)31(36-29)13-26(16)34-22/h9,12-15,34-37,40-41H,2-3,7-8,10-11H2,1,4-6H3,(H,38,39) |
| InChIKey | WOIPQRZBVUOOIM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 159.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|