C30H34Br2N4 — CID 54483603
3,7-bis(3-bromopropyl)-2,8,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin (PubChem CID 54483603) has the molecular formula C30H34Br2N4 and a molecular weight of 610.44 g/mol. Its IUPAC name is 3,7-bis(3-bromopropyl)-2,8,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 3,7-bis(3-bromopropyl)-2,8,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 54483603 |
| Molecular Formula | C30H34Br2N4 |
| Molecular Weight | 610.44 g/mol |
| Exact Mass | 608.12 |
| IUPAC Name | 3,7-bis(3-bromopropyl)-2,8,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin |
| SMILES | Cc1cc2[nH]c1C=c1cc(C)c([nH]1)=Cc1[nH]c(c(CCCBr)c1C)C=c1[nH]c(c(C)c1CCCBr)=C2 |
| InChI | InChI=1S/C30H34Br2N4/c1-17-11-22-14-27-19(3)23(7-5-9-31)29(35-27)16-30-24(8-6-10-32)20(4)28(36-30)15-26-18(2)12-21(34-26)13-25(17)33-22/h11-16,33-36H,5-10H2,1-4H3 |
| InChIKey | CLGHVZQYKQJHKR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|