C48H58N6 — CID 54451792
N-benzyl-3-[18-[3-(benzylamino)propyl]-8,13-diethyl-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propan-1-amine (PubChem CID 54451792) has the molecular formula C48H58N6 and a molecular weight of 719.03 g/mol. Its IUPAC name is N-benzyl-3-[18-[3-(benzylamino)propyl]-8,13-diethyl-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propan-1-amine.
| Compound Name | N-benzyl-3-[18-[3-(benzylamino)propyl]-8,13-diethyl-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 54451792 |
| Molecular Formula | C48H58N6 |
| Molecular Weight | 719.03 g/mol |
| Exact Mass | 718.47 |
| IUPAC Name | N-benzyl-3-[18-[3-(benzylamino)propyl]-8,13-diethyl-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propan-1-amine |
| SMILES | CCc1c2[nH]c(c1C)C=c1[nH]c(c(CCCNCc3ccccc3)c1C)=Cc1[nH]c(c(C)c1CCCNCc1ccccc1)C=c1[nH]c(c(C)c1CC)=C2 |
| InChI | InChI=1S/C48H58N6/c1-7-37-31(3)41-25-42-33(5)39(21-15-23-49-29-35-17-11-9-12-18-35)47(53-42)28-48-40(22-16-24-50-30-36-19-13-10-14-20-36)34(6)44(54-48)27-46-38(8-2)32(4)43(52-46)26-45(37)51-41/h9-14,17-20,25-28,49-54H,7-8,15-16,21-24,29-30H2,1-6H3 |
| InChIKey | PIXOYXSFTRSWNO-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.03 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|