C34H44N4 — CID 54269707
2,7-diethyl-3,8,12,18-tetramethyl-13,17-dipropyl-21,22,23,24-tetrahydroporphyrin (PubChem CID 54269707) has the molecular formula C34H44N4 and a molecular weight of 508.75 g/mol. Its IUPAC name is 2,7-diethyl-3,8,12,18-tetramethyl-13,17-dipropyl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 2,7-diethyl-3,8,12,18-tetramethyl-13,17-dipropyl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 54269707 |
| Molecular Formula | C34H44N4 |
| Molecular Weight | 508.75 g/mol |
| Exact Mass | 508.36 |
| IUPAC Name | 2,7-diethyl-3,8,12,18-tetramethyl-13,17-dipropyl-21,22,23,24-tetrahydroporphyrin |
| SMILES | CCCc1c2[nH]c(c1C)C=c1[nH]c(c(C)c1CC)=Cc1[nH]c(c(C)c1CC)C=c1[nH]c(c(CCC)c1C)=C2 |
| InChI | InChI=1S/C34H44N4/c1-9-13-25-21(7)28-15-27-19(5)23(11-3)31(35-27)16-29-20(6)24(12-4)32(36-29)17-30-22(8)26(14-10-2)34(38-30)18-33(25)37-28/h15-18,35-38H,9-14H2,1-8H3 |
| InChIKey | URVRSGKBHUABSC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.75 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |