C44H64N4 — CID 123622064
2,3,7,8,12,13,17,18-octapropyl-21,22,23,24-tetrahydroporphyrin (PubChem CID 123622064) has the molecular formula C44H64N4 and a molecular weight of 649.02 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octapropyl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 2,3,7,8,12,13,17,18-octapropyl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 123622064 |
| Molecular Formula | C44H64N4 |
| Molecular Weight | 649.02 g/mol |
| Exact Mass | 648.51 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octapropyl-21,22,23,24-tetrahydroporphyrin |
| SMILES | CCCc1c2[nH]c(c1CCC)C=c1[nH]c(c(CCC)c1CCC)=Cc1[nH]c(c(CCC)c1CCC)C=c1[nH]c(c(CCC)c1CCC)=C2 |
| InChI | InChI=1S/C44H64N4/c1-9-17-29-30(18-10-2)38-26-40-33(21-13-5)34(22-14-6)42(47-40)28-44-36(24-16-8)35(23-15-7)43(48-44)27-41-32(20-12-4)31(19-11-3)39(46-41)25-37(29)45-38/h25-28,45-48H,9-24H2,1-8H3 |
| InChIKey | QUBVSPGZFRBEDZ-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.02 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |