C36H40N4O4 — CID 54011745
methyl 3-[7,17-bis(ethenyl)-12-(3-methoxy-3-oxopropyl)-3,8,13,18-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate (PubChem CID 54011745) has the molecular formula C36H40N4O4 and a molecular weight of 592.74 g/mol. Its IUPAC name is methyl 3-[7,17-bis(ethenyl)-12-(3-methoxy-3-oxopropyl)-3,8,13,18-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[7,17-bis(ethenyl)-12-(3-methoxy-3-oxopropyl)-3,8,13,18-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 54011745 |
| Molecular Formula | C36H40N4O4 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | methyl 3-[7,17-bis(ethenyl)-12-(3-methoxy-3-oxopropyl)-3,8,13,18-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate |
| SMILES | C=Cc1c(C)c2[nH]c1=Cc1[nH]c(c(CCC(=O)OC)c1C)C=c1[nH]c(c(C=C)c1C)=Cc1[nH]c(c(CCC(=O)OC)c1C)C=2 |
| InChI | InChI=1S/C36H40N4O4/c1-9-23-19(3)27-17-33-26(12-14-36(42)44-8)22(6)30(40-33)16-32-24(10-2)20(4)28(38-32)18-34-25(11-13-35(41)43-7)21(5)29(39-34)15-31(23)37-27/h9-10,15-18,37-40H,1-2,11-14H2,3-8H3 |
| InChIKey | CXQCGWFXFXQDPK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |