C36H44N4O6 — CID 124525670
methyl 3-[13-[(1R)-1-hydroxyethyl]-8-[(1S)-1-hydroxyethyl]-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate (PubChem CID 124525670) has the molecular formula C36H44N4O6 and a molecular weight of 628.77 g/mol. Its IUPAC name is methyl 3-[13-[(1R)-1-hydroxyethyl]-8-[(1S)-1-hydroxyethyl]-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[13-[(1R)-1-hydroxyethyl]-8-[(1S)-1-hydroxyethyl]-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 124525670 |
| Molecular Formula | C36H44N4O6 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.33 |
| IUPAC Name | methyl 3-[13-[(1R)-1-hydroxyethyl]-8-[(1S)-1-hydroxyethyl]-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate |
| SMILES | COC(=O)CCc1c2[nH]c(c1C)C=c1[nH]c(c(C)c1[C@@H](C)O)=Cc1[nH]c(c(C)c1[C@H](C)O)C=c1[nH]c(c(CCC(=O)OC)c1C)=C2 |
| InChI | InChI=1S/C36H44N4O6/c1-17-23(9-11-33(43)45-7)29-16-30-24(10-12-34(44)46-8)18(2)26(38-30)14-31-36(22(6)42)20(4)28(40-31)15-32-35(21(5)41)19(3)27(39-32)13-25(17)37-29/h13-16,21-22,37-42H,9-12H2,1-8H3/t21-,22+/m0/s1 |
| InChIKey | NCZKVYGGDVUBMH-FCHUYYIVSA-N |
| XLogP | 2.18 |
| TPSA | 156.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |