C35H40N4O2 — CID 123182289
methyl 3-[7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-propyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate (PubChem CID 123182289) has the molecular formula C35H40N4O2 and a molecular weight of 548.73 g/mol. Its IUPAC name is methyl 3-[7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-propyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-propyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 123182289 |
| Molecular Formula | C35H40N4O2 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | methyl 3-[7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-propyl-21,22,23,24-tetrahydroporphyrin-2-yl]propanoate |
| SMILES | C=Cc1c2[nH]c(c1C)C=c1[nH]c(c(CCC)c1C)=Cc1[nH]c(c(C)c1CCC(=O)OC)C=c1[nH]c(c(C)c1C=C)=C2 |
| InChI | InChI=1S/C35H40N4O2/c1-9-12-25-21(6)28-15-27-19(4)23(10-2)31(36-27)16-29-20(5)24(11-3)32(37-29)17-30-22(7)26(13-14-35(40)41-8)34(39-30)18-33(25)38-28/h10-11,15-18,36-39H,2-3,9,12-14H2,1,4-8H3 |
| InChIKey | IWJMERUVFOKMMX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |