C48H56N4 — CID 123821815
2,3,7,8,12,13,17,18-octaethyl-5,10-diphenyl-21,22,23,24-tetrahydroporphyrin (PubChem CID 123821815) has the molecular formula C48H56N4 and a molecular weight of 689.00 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octaethyl-5,10-diphenyl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 2,3,7,8,12,13,17,18-octaethyl-5,10-diphenyl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 123821815 |
| Molecular Formula | C48H56N4 |
| Molecular Weight | 689.00 g/mol |
| Exact Mass | 688.45 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octaethyl-5,10-diphenyl-21,22,23,24-tetrahydroporphyrin |
| SMILES | CCc1c2[nH]c(c1CC)C(c1ccccc1)=c1[nH]c(c(CC)c1CC)=C(c1ccccc1)c1[nH]c(c(CC)c1CC)C=c1[nH]c(c(CC)c1CC)=C2 |
| InChI | InChI=1S/C48H56N4/c1-9-31-32(10-2)40-28-42-34(12-4)36(14-6)46(51-42)44(30-25-21-18-22-26-30)48-38(16-8)37(15-7)47(52-48)43(29-23-19-17-20-24-29)45-35(13-5)33(11-3)41(50-45)27-39(31)49-40/h17-28,49-52H,9-16H2,1-8H3 |
| InChIKey | SOJGATOCTLIVCF-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.00 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |